On Target PDE4B_HUMAN 0.40408164/CHEMBL3944139
For the given ligand pmi, we have found in our database that, being scored 0.40408164, the most similar ligand is CHEMBL3944139. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3944139 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | COc1ccc(cc1OC)C2=NN(C3CCN(CC3)C(=O)CN4C(=O)Cc5ccccc45)C(=O)C2(C)C |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 0082400e 43c03608 20100128 24011680 20401000 40000040 02040001 2110400a 00000980 00080be1 0839000c 5001b004 8700c002 20102000 c1020141 000c8008 00248400 02001000 08080408 00020a01 c0180500 382c0600 60042003 8b50001b 00200800 88400a82 40120010 10001080 0c088208 000f021b 60207000 20002600 |