On Target ACM4_HUMAN 0.41935483/CHEMBL3354077
For the given ligand pmi, we have found in our database that, being scored 0.41935483, the most similar ligand is CHEMBL3354077. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3354077 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | OCCCCCCCCCCCCCC1CCN(CCCN2C(=O)CCc3ccccc23)CC1 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00004002 01001600 00100100 00010600 20080000 00002040 02000000 20000000 00000800 000809e0 08380024 50019000 04008002 00900000 00020040 000c000a 00048000 02000000 08402008 00000201 60100100 18080610 21002000 00500018 00000800 81000000 00000010 10001080 00088000 0006001b 00020080 20002600 |