On Target TNFA_HUMAN 0.3811189/CHEMBL2337617
For the given ligand 7mi, we have found in our database that, being scored 0.3811189, the most similar ligand is CHEMBL2337617. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL2337617 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COC(=O)[C@@H]1[C@H](ON=C1c2ccccc2)c3cc(OC)c(O)c4c3C[C@@H]5[C@@H]6C=C(OC)C(=O)C[C@]46CCN5C |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00010000 4b210208 2010010a 00150f00 02081021 d0444002 170c11c0 30000603 011889e8 031988db 28310000 5181d840 9406c81a 20a00000 0300042d 020fa018 20820200 82200060 01496028 42860651 00000d00 18208ab8 0120c040 81540010 00200800 90022205 6c524000 92800180 0400420b 0006c40a 6c0e0000 00012600 |