On Target ACHA9_HUMAN 0.3172691/CHEMBL386114
For the given ligand pmi, we have found in our database that, being scored 0.3172691, the most similar ligand is CHEMBL386114. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL386114 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | C[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)CN)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00070002 01007a00 00100100 45910e10 00141282 00000010 00012000 2000000c 00600880 020f08c2 08300014 4003b000 1e008812 00442809 80180040 000c000c 10000800 02000001 00e00418 00400301 40000100 38348e28 23800283 97500018 00043801 80000000 48010000 10000000 0c000002 0006002b 20044200 03812e20 |