On Target BACE1_HUMAN 0.4869565/CHEMBL3907751
For the given ligand mi, we have found in our database that, being scored 0.4869565, the most similar ligand is CHEMBL3907751. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL3907751 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | Cc1cccc(c1)C2CC(CCN2C(=O)[C@@H]3CNC[C@]34CCCc5nc(Cl)ccc45)c6ccccc6 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0003800a 03805600 00504102 11810610 00041321 00000012 15002000 22001001 00600880 000909e0 08308004 50839800 0f00882e 00200800 40020400 020e000c 00000200 06000004 00202418 00000201 c0100100 18348710 21804000 91500018 00045800 c0000101 08040040 90004080 04400106 0086001b 20062000 20822602 |