On Target NEP_HUMAN 0.50678736/CHEMBL305388
For the given ligand mi, we have found in our database that, being scored 0.50678736, the most similar ligand is CHEMBL305388. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL305388 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COc1ccc2[C@@H](CCc2c1)[C@@H](CS)C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)O |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 00010002 43005e08 2010010a 41910610 00041080 40000002 03042000 20000005 00600880 000908c0 08300004 4003b000 1e00880a 20641800 81080041 020e000c 10000000 02000000 00682408 00420201 60000100 18208e18 23804340 91500018 00043801 80000001 08120000 10000000 04000202 0006003b 20044200 01012620 |