On Target HPGDS_HUMAN 0.31128404/CHEMBL3134496
For the given ligand 7mi, we have found in our database that, being scored 0.31128404, the most similar ligand is CHEMBL3134496. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL3134496 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | O=C(NC1CCCC1)N2Cc3cc(cnc3C2)c4c[nH]nc4C5CC5 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 10000002 41809009 20104180 10000e10 01061020 0410000a 10004005 02007203 00000900 000c00d0 01318004 40010040 88009802 09200000 20020c81 8204210c 000640c0 06001006 04600040 102a1843 c0020100 18058c00 24804800 00500118 00952001 c0200001 48120240 90000040 00409104 01060003 000c0020 80004220 |