On Target NOS1_HUMAN 0.4484536/CHEMBL85823
For the given ligand 7mi, we have found in our database that, being scored 0.4484536, the most similar ligand is CHEMBL85823. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL85823 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COc1ccc2[C@H]3CCC[C@H]3C(=Nc2c1)N |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00000002 81200208 2000010a 00010e20 00001000 00200000 13040010 00002000 00000800 000808c3 08110004 40018000 10001002 48200008 010200c1 00000008 02000800 02000000 01002008 10020401 40000101 18010110 20000000 60400810 00090800 88100001 40120400 00000800 00080202 0186000a 000a0000 20100500 |