On Target NOS1_HUMAN 0.3909091/CHEMBL3216558
For the given ligand pmi, we have found in our database that, being scored 0.3909091, the most similar ligand is CHEMBL3216558. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3216558 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | Cl.Cl.CN1CCC(C1)N2CCCCc3cc(NC(=N)c4cccs4)ccc23 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00014002 01001410 42100122 04010600 20040000 00002050 01000080 22001200 00500900 08080bf3 08300204 4001c080 00000892 00202820 00022040 00080002 00249000 03000008 08200008 00000209 64121100 78048080 20010001 02500012 02040000 84000002 40000000 90001084 08488318 00060012 02000080 24c32600 |