On Target NK1R_HUMAN 0.39555556/CHEMBL286640
For the given ligand 7mi, we have found in our database that, being scored 0.39555556, the most similar ligand is CHEMBL286640. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL286640 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CO\N=C(/CNC(=O)c1ccccc1OC)\C(CCN2CCC(O)(CC2)c3ccccc3)c4ccc(Cl)c(Cl)c4 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00008000 05001a08 21100109 00010e00 00001000 08024100 06000040 22005402 001089c0 101808c1 08330000 50018800 02008826 00000001 89000401 000c2018 00000000 02040000 00800400 00620201 80000100 18068720 c1000880 0054001c 00002001 c6100004 48040800 90000000 00000300 0006000b f40c0000 00022600 |