On Target ALDR_HUMAN 0.35497835/CHEMBL281620
For the given ligand pmi, we have found in our database that, being scored 0.35497835, the most similar ligand is CHEMBL281620. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL281620 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | Fc1ccc(CN2CC3(NC(=O)NC3=O)c4cc(F)ccc24)cc1 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00004002 01803400 00100120 06010e00 21000000 00100050 00000004 0200300c 00000080 200b2b60 09200004 5000f000 0d00b802 00003000 40020560 00000000 0004c018 03002104 08000010 00b00201 e0120500 38298600 20010000 8344001b 00001004 c0000201 80000000 80001081 0c288100 00068813 20146000 e0000600 |