On Target AA1R_HUMAN 0.37668163/CHEMBL3350613
For the given ligand pmi, we have found in our database that, being scored 0.37668163, the most similar ligand is CHEMBL3350613. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3350613 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | CC(C)(C)OC(=O)C1CCCN1C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)N)NC(=O)OCc3ccccc3 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 01030000 01407400 00100102 84010700 00080080 0001c010 00000000 2000000c 00b00b80 000809e0 08300000 4003b000 0e008012 01212002 80381008 021a1008 10820000 02080401 00400890 00000201 00000120 38280eb0 13000041 83500018 00004400 80002002 00000000 10200021 0c000202 00060013 e0004000 00802600 |