On Target PGH1_SHEEP 0.2742616/CHEMBL47687
For the given ligand 7mi, we have found in our database that, being scored 0.2742616, the most similar ligand is CHEMBL47687. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL47687 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COc1ccc(cc1)n2nc(cc2c3ccc(N)cc3)C(F)(F)F |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00006026 00000a08 a0100108 00010600 01081000 00004002 02440400 00001408 00000104 000108f0 09010004 6000800a 00000812 02000200 01000041 000c200c 00020000 02801000 04400000 00220008 40100000 1803a020 30800800 83404008 00000000 c0000040 30060000 90000861 04004304 00460008 40260200 830026a2 |