On Target PGH1_SHEEP 0.48430493/CHEMBL24798
For the given ligand mi, we have found in our database that, being scored 0.48430493, the most similar ligand is CHEMBL24798. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL24798 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CCC(C)[C@@H](CO)NC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c3ccc(OC)cc13 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 00008002 01005a08 20100188 51010718 000c50a0 00000000 060c2000 20001000 80500080 000908c0 08200004 4001b800 13008866 00608000 c10a0041 020c000c 10810200 83800004 01680400 00020201 40000000 18268718 23804001 9150001c 00042000 c0000100 08160000 10000000 04000204 0006004b 80042200 00022620 |