On Target PGH1_SHEEP 0.33333334/CHEMBL9192
For the given ligand pmi, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL9192. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL9192 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | C[C@]1(CCC(=O)NC1=O)N2C(=O)c3cccc(N)c3C2=O |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 10038002 01803800 00100100 14010600 00000000 00118000 00000080 22001008 00a00000 000308c0 00200004 5003b000 06008812 00202000 00020540 10000000 00002000 02000002 00100000 00000201 c0020000 38068680 20000001 0250001c 00040000 c0200000 00004000 90000000 08400100 00060001 a0044000 40802200 |