On Target CNR1_HUMAN 0.4/CHEMBL409927
For the given ligand 7mi, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL409927. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL409927 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | OC(CC[C@H]1[C@@H](N(C1=O)c2ccc(F)cc2)c3ccc(O)cc3)c4ccc(F)cc4 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00014002 01801208 20100102 02010600 21080000 00006010 02000000 22001000 00000900 000808c0 08380004 5001d000 0c00882a 01b01000 00020441 000c0008 00040000 02000280 08402018 00320201 c0100100 18048630 21012000 00500018 00000800 c0000000 00320000 90000081 00008102 0006800b 60060000 00000600 |