On Target GRM5_HUMAN 0.3272059/CHEMBL3122225
For the given ligand 7mi, we have found in our database that, being scored 0.3272059, the most similar ligand is CHEMBL3122225. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL3122225 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | C[C@@H]1CCCN1C(=O)c2nn(C)c3nc(OCc4ccccn4)ccc23 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 04048006 01001c18 621a4108 18000f00 810c1020 00004156 06000000 22203c0c 00000b00 011000c0 0835002c 44118000 82809806 00a10000 61020741 021c200c 14218008 02800000 00600000 00220201 40020060 1c078630 a1800843 82f0111c 00206401 c0002004 00220048 90000800 01000304 00060001 e40cc080 0c000320 |