On Target GRM5_HUMAN 0.36888888/CHEMBL3915745
For the given ligand pmi, we have found in our database that, being scored 0.36888888, the most similar ligand is CHEMBL3915745. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3915745 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | CN1[C@@H]2CCCC[C@@H]2[C@H](C1=O)c3ccc(cn3)C#Cc4ccccc4 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 1403020a 01025208 00104922 10090610 00443020 00000010 01000020 20000000 00000980 00080ad0 08318004 40819804 0500888a 00200000 41020000 0204000c 00000000 0e000004 02202008 00000211 60100100 18a48610 20800001 83500018 00041004 80000080 08800240 10000180 04400006 0086000b 00027000 20802700 |