On Target DRD3_HUMAN 0.47727272/CHEMBL136961
For the given ligand pmi, we have found in our database that, being scored 0.47727272, the most similar ligand is CHEMBL136961. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL136961 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | O=C(CCCCN1CCN2C(CCc3ccccc23)C1)c4ccccc4 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00014002 01000a00 00100122 04010600 20000000 00002040 01000000 20000000 00100800 00080ac0 08300004 40019000 04008012 00202000 00020040 00040000 00248000 02000000 08002008 00000201 40100100 38020210 20000021 02500016 00000000 81000000 00000000 10001080 08088002 0006000a 80000080 20002600 |