On Target OPRM_MOUSE 0.369863/CHEMBL3339378
For the given ligand 7mi, we have found in our database that, being scored 0.369863, the most similar ligand is CHEMBL3339378. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL3339378 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | Oc1ccc2CC3N(CC4CC4)CCC56C(Oc1c25)[C@@]7(O)CC[C@@]36N=C7C(=O)NCc8ccccc8 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 04051002 43802208 2030454a 04210f00 00181063 c2010002 12001000 22023259 03a00890 70091cc1 08330100 708390c0 5494e80a 21a02080 11340429 220ca018 18a00a30 22008102 06c82020 004a0201 80000101 38218610 850040c1 8b500c18 00020081 c0020001 40120200 90800020 0ca00302 2007c80b 20060000 04442f40 |