On Target NOS2_HUMAN 0.38697317/CHEMBL1911986
For the given ligand mi, we have found in our database that, being scored 0.38697317, the most similar ligand is CHEMBL1911986. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL1911986 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | Cc1cc(nc(n1)n2ccnc2)C3CCCN3C(=O)NCCc4ccc5OCOc5c4 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 00000002 43801808 2010110a 40050e00 450010c4 80104012 13042004 08007107 00300900 000c08c0 4933800c 40018800 0800d003 20300000 01020401 002c800c 0020c008 06800002 80480048 00220a41 80240720 1c258400 258008c0 8150011c 40116400 c1000600 08120000 b0000080 0500130c 00460003 60088000 a00146a0 |