On Target NOS2_HUMAN 0.3783784/CHEMBL220213
For the given ligand pmi, we have found in our database that, being scored 0.3783784, the most similar ligand is CHEMBL220213. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL220213 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | O=C(CC1CCCCN1c2cccc(c2)n3ccnc3)NCc4ccc5OCOc5c4 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00014002 45800408 20100108 00010600 20001040 0a002000 02048000 22001000 00200100 000009e0 4020800c 50019000 0c00d80a 24000000 01060441 002c800c 08040008 02000000 08482010 00020201 e0140200 18008610 21000040 81548018 40081000 c0100000 00228400 b0000088 05808300 00460011 60060000 00012200 |