On Target SCN9A_HUMAN 0.4212963/CHEMBL569285
For the given ligand 7mi, we have found in our database that, being scored 0.4212963, the most similar ligand is CHEMBL569285. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL569285 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | FC(F)(F)Oc1ccc(CNC(=O)[C@@H]2CCC[C@H]2C3=NOC(C3)c4ccccc4)cc1 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00010000 01a00008 2190010a 00010e00 02081010 10005000 12040040 22007402 00188960 000908c1 08310000 40419000 8400880a 00a00000 01000409 00080018 00000000 02200000 00402400 00020611 80000500 18018630 01000008 00500018 00000000 c0000005 48220000 d0000000 02004303 01060003 600e0000 00000600 |