On Target SCN9A_HUMAN 0.53521127/CHEMBL247829
For the given ligand pmi, we have found in our database that, being scored 0.53521127, the most similar ligand is CHEMBL247829. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL247829 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | CC(C)N1C(=O)[C@H](CCc2ccccc12)NC(=O)[C@@H](Cc3ccccc3OC(F)(F)F)NC(=O)OC(C)(C)C |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00014002 01403208 2010012a 04010600 20001010 0001a040 07000000 2000020c 00d00a00 08080ac0 08380024 4841b0c0 0e008002 00302001 81020041 001e200a 90268000 02080000 08000818 00020201 40100100 38240e10 2000200b 8350041a 00000840 c0000002 00000010 d02010a0 0e088300 0006800b a0004080 20402600 |