On Target TRY1_HUMAN 0.3802817/CHEMBL45106
For the given ligand 7mi, we have found in our database that, being scored 0.3802817, the most similar ligand is CHEMBL45106. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL45106 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COC(=O)[C@H](Cc1cccc(c1)C(=N)N)[C@@H](CC2CCCCC2)NC(=O)c3ccc(cc3)c4cccc(CN)c4 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00012000 01001a08 00100102 40010700 00080001 04000000 00000000 22001000 00000900 000808c3 08300000 40019000 8c00880a 00a00000 00000400 000c0008 00a20000 02001001 06c02418 10000201 00000100 18168e10 110000c0 0050001c 00001801 c0000000 48000000 90000041 0000430a 0006000b e0060000 00000600 |