On Target TRY1_HUMAN 0.4496124/CHEMBL87502
For the given ligand pmi, we have found in our database that, being scored 0.4496124, the most similar ligand is CHEMBL87502. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL87502 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | COc1cccc2N(CC(=O)N[C@H]3CCCN(C3O)C(=N)N)C(=O)[C@H](CCc12)NS(=O)(=O)Cc4ccccc4.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00014082 85007228 2010212a 05312e00 30089080 0000a040 03020004 2010a208 00300e00 08480ac6 0838242c 5003b040 0600f022 09342001 81520041 0018a00a 10258098 02000100 08600008 00026e05 c0140100 3c850e40 23002003 3250043a 02000000 c0000080 40001010 9000108c 08088310 0006c00b a0085080 20530670 |