On Target ACE_HUMAN 0.5253456/CHEMBL148616
For the given ligand mi, we have found in our database that, being scored 0.5253456, the most similar ligand is CHEMBL148616. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL148616 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | C[C@H](CS)C(=O)N1Cc2[nH]c3ccccc3c2CC1C(=O)O |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0001801a 0080d800 00100100 51910e10 000410a0 00100000 01003000 02003005 00400880 00090840 08310004 4000b000 1e008882 00648800 800a04c0 020c010c 10000200 02000026 00600408 00400a01 c0020100 18218e08 23804240 91400018 00143801 c0000001 08004000 80000000 04000104 00860023 20044200 01016620 |