On Target ACE_HUMAN 0.47342995/CHEMBL417169
For the given ligand pmi, we have found in our database that, being scored 0.47342995, the most similar ligand is CHEMBL417169. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL417169 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | CCOC(=O)[C@H](CCCCN)N[C@H]1CCc2ccccc2N(CC(=O)O)C1=O |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00014002 01004200 00101122 84010700 20080080 00002040 03000000 20100100 00100800 08080ac0 08382024 4001b000 0600800a 00b02003 801a1048 000c100a 10a68000 02000000 08402008 00000201 40100120 38000e30 33002001 0250001a 00000400 80000080 08000010 10001081 08088200 0006000b 20005080 20402600 |