On Target TLR4_HUMAN 0.3315508/CHEMBL1223752
For the given ligand pmi, we have found in our database that, being scored 0.3315508, the most similar ligand is CHEMBL1223752. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL1223752 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | CC(C)CC(=O)Nc1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 04014002 01000008 20100008 00010700 20081000 02002000 02000000 00000008 00000000 000008c0 00280004 40009000 0480802a 00900000 11030041 00082008 00860000 00000000 0a402000 00020001 40100000 18000e00 31002000 00000010 00000000 00000000 00040000 10000080 00008200 00060001 00020000 10000200 |