On Target MTOR_HUMAN 0.409894/CHEMBL2334763
For the given ligand mi, we have found in our database that, being scored 0.409894, the most similar ligand is CHEMBL2334763. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL2334763 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CCNC(=O)Nc1ccc(cc1)c2nc3[C@H]4CC[C@@H](Cc3c(n2)N5CCOC[C@@H]5C)N4C6COC6 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 1001001e 01000820 c0103102 d98d0e10 050001a0 08104052 0140b004 28083941 10d00980 100908d0 203da004 40819800 0c009082 00308800 000a1468 000c010c 11048a08 06406022 88402018 40600201 45320520 1825a410 33826040 10500118 10147400 c0000601 08004008 900010a1 0408830e 00e60c03 60029880 200062e0 |