On Target OPRX_HUMAN 0.3776596/CHEMBL233493
For the given ligand 7mi, we have found in our database that, being scored 0.3776596, the most similar ligand is CHEMBL233493. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL233493 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COc1ccccc1C2(O)CCN(CC2)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00000000 01000208 20100108 00010600 00001000 00004000 02000000 23001a00 00000900 000808c0 08300000 50018040 00000802 00000000 01000401 000c2008 00000000 02000000 00800000 00020201 00000100 18008020 01000080 00500410 00000001 e0000000 00000000 d0000000 00000380 0006800a 60044000 00000600 |