On Target OPRX_HUMAN 0.49479166/CHEMBL2064143
For the given ligand pmi, we have found in our database that, being scored 0.49479166, the most similar ligand is CHEMBL2064143. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL2064143 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | CN(C)C(=O)C1Cc2ccccc2N1C(=O)CCN3CCC(CC3)C4CCCCC4 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00004002 01003600 00100120 04010600 20000000 00000040 02000000 2010000c 00000880 00080be0 08380024 5001b000 0e008002 00102000 80020140 00040002 00248000 02000000 0a002018 00000201 60100100 38200610 20002001 8350001b 00001800 80000080 00000010 10001080 0c088000 0006001b 20025080 20002600 |