On Target CAH2_HUMAN 0.44927537/CHEMBL2335178
For the given ligand mi, we have found in our database that, being scored 0.44927537, the most similar ligand is CHEMBL2335178. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL2335178 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | C(c1ccc(Cn2c3CCCCCc3c4ccccc24)cc1)n5c6CCCCCc6c7ccccc57 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0000000a 01004a00 00101102 50810618 00045120 00000002 01002000 00001101 80500900 100808c0 08108004 40818000 88000820 00608800 00030060 0a040004 01000000 86800004 00282408 00010001 40100100 18008018 20804000 81500414 00042000 c0000001 08000000 10000080 04000006 0086004a 00060200 20000420 |