On Target CDK5_HUMAN 0.46445498/CHEMBL2005528
For the given ligand mi, we have found in our database that, being scored 0.46445498, the most similar ligand is CHEMBL2005528. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL2005528 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CCOC(=O)c1ccc2[nH]c3C(=O)NCCc3c2c1 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0000000a 00009800 00100100 51050e10 00041031 0010c000 00002000 02003005 00400180 00090840 08290004 40008800 10008802 00718000 00020440 020c010c 00020000 02000026 00200400 00000200 40820000 18278e68 20806000 9140001c 00142400 c0002000 08080040 80000000 04400304 00060003 c0040200 00004620 |