On Target PTGES_HUMAN 0.33043477/CHEMBL4078000
For the given ligand 7mi, we have found in our database that, being scored 0.33043477, the most similar ligand is CHEMBL4078000. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL4078000 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | OC(=O)c1ccc(Cl)cc1OC[C@@H]2CCC[C@@H]2NC(=O)C3CCN(CC3)c4ccc(cc4)C(F)(F)F |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 0402c002 01001808 20100108 00010700 20081000 02026000 92000400 20000800 00200100 000808d0 00200004 50039820 06808086 01808002 11020043 00082008 00a40000 22008000 08c02000 00020201 40100000 18160f30 21000080 0050001c 00002001 80000000 00040a00 90000080 00008300 01060001 c0104000 00822240 |