On Target PTGES_HUMAN 0.405/CHEMBL4084995
For the given ligand pmi, we have found in our database that, being scored 0.405, the most similar ligand is CHEMBL4084995. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL4084995 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | OC(=O)c1ccccc1CC[C@@H]2CCC[C@@H]2NC(=O)C3CCN(CC3)c4ccc(OC(F)(F)F)cc4 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00024002 01001808 2010010a 00010600 20001010 0000e000 02000000 20000008 00300900 000808c0 08300004 50439800 04008022 00200000 01020061 00080008 00040000 02000000 08002000 00020201 40500500 18060e70 20004008 0050001c 00000000 80000201 00040000 d0000080 02008202 01060003 c0020000 00802600 |