On Target 5HT2B_HUMAN 0.5738636/CHEMBL3947432
For the given ligand pmi, we have found in our database that, being scored 0.5738636, the most similar ligand is CHEMBL3947432. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3947432 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | COc1cccc2N3CCCNC[C@H]3CCc12 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00004002 81000608 2010012a 04010600 20001000 00002040 03000000 20000200 00100800 00080be0 08300004 40018040 00000002 08202000 01020041 0004200a 00248080 02000000 08000008 00022601 68100100 38000000 20000001 02500412 00000000 c1000000 00000000 10001080 08088300 0006c01a 00000080 20022600 |