On Target IKKB_HUMAN 0.33035713/CHEMBL3823257
For the given ligand 7mi, we have found in our database that, being scored 0.33035713, the most similar ligand is CHEMBL3823257. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL3823257 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | COC(=O)C(=C)CC1(O)C(=O)Nc2ccccc12 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00054002 01000000 00101112 00010700 20280080 00006000 01000000 00000400 11000900 001a08c2 083800a4 4001d000 05008030 01300000 40020144 00080008 0086c000 02000000 18400018 00000001 40100100 18200e20 23002000 81500011 00000000 80000200 08000010 90001080 04008200 80060003 44002080 20410610 |