On Target IKKB_HUMAN 0.4097561/CHEMBL3823257
For the given ligand pmi, we have found in our database that, being scored 0.4097561, the most similar ligand is CHEMBL3823257. Check out the elaboration below.
| pmi (Given Ligand) | CHEMBL3823257 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(Nc1cccc(OC)c1C2=O)C3CC4/C(=C\OC)C(=O)OC | COC(=O)C(=C)CC1(O)C(=O)Nc2ccccc12 |
|
|
|
|
|
|
| 10034002 81000e08 2010012a 14010700 20081000 00032050 03000000 20001600 11900800 00380be0 08300004 5001b0c0 8c00801a 09a02000 03020541 000c200a 90a64080 02000000 08452018 00022601 60100100 38220a10 21000001 83500417 00001000 c0000080 00001800 90001080 0c00c302 0006c01a a402d000 20822610 | 00054002 01000000 00101112 00010700 20280080 00006000 01000000 00000400 11000900 001a08c2 083800a4 4001d000 05008030 01300000 40020144 00080008 0086c000 02000000 18400018 00000001 40100100 18200e20 23002000 81500011 00000000 80000200 08000010 90001080 04008200 80060003 44002080 20410610 |