On Target MK03_HUMAN 0.2927928/CHEMBL3798926
For the given ligand 7mi, we have found in our database that, being scored 0.2927928, the most similar ligand is CHEMBL3798926. Check out the elaboration below.
| 7mi (Given Ligand) | CHEMBL3798926 (Similar Ligand) |
|---|---|
| CCC4CN3CCC2(O)/C(=N\c1cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | O=C(NCCCc1ccccc1)c2ccc3[nH]nc(c4ccncc4)c3c2 |
|
|
|
|
|
|
| 00010002 81000208 2010410a 10010f20 10081000 00204000 13000050 20027e02 11080940 003808c1 0a330004 70019040 9400901a 49a00000 03020cc1 000c2108 02824800 02000030 10c42038 00620601 c0000101 18010a30 e1201880 20500c18 00090801 c8100000 40001400 90000800 00085302 0006c00a 640ac001 24102610 | 00002002 00009a08 a0104100 40010600 01040000 00000002 02400000 22001000 00000900 000808c0 08300004 60008000 80008812 00400000 00000400 000c200c 00220000 02000004 04600000 10220201 40000100 1c068608 30800800 0060401c 00100000 c0000000 10020000 90000060 00004104 0006000b a0040400 00004620 |