On Target MK03_HUMAN 0.35514018/CHEMBL3798926
For the given ligand mi, we have found in our database that, being scored 0.35514018, the most similar ligand is CHEMBL3798926. Check out the elaboration below.
| mi (Given Ligand) | CHEMBL3798926 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | O=C(NCCCc1ccccc1)c2ccc3[nH]nc(c4ccncc4)c3c2 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 00002002 00009a08 a0104100 40010600 01040000 00000002 02400000 22001000 00000900 000808c0 08300004 60008000 80008812 00400000 00000400 000c200c 00220000 02000004 04600000 10220201 40000100 1c068608 30800800 0060401c 00100000 c0000000 10020000 90000060 00004104 0006000b a0040400 00004620 |