On Target ADRB2_HUMAN 0.43258426/CHEMBL513389
For the given ligand Morphine, we have found in our database that, being scored 0.43258426, the most similar ligand is CHEMBL513389. Check out the elaboration below.
| Morphine (Given Ligand) | CHEMBL513389 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2[C@@H](O)/C=C\[C@H]3[C@H]4C5 | CC(C)NC(C)C(O)COc1ccc(C)c2CCCc12 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000002 02081000 38000643 00000890 001818ca 08300300 51818040 00824002 21a00080 11240425 020ca018 08800200 22008060 04492010 0002a201 00000100 18200010 0500e040 89540410 00201000 c0002401 04524200 90800000 04000302 0007cc0a 24020000 00012f40 | 04000000 43000008 2010010a 00010700 00001081 c2000000 02040000 00000200 00000810 00080840 08300000 40008040 00800002 20201080 11200021 000a2008 10200000 22008000 00c80000 00020201 00000100 18000000 07004080 08400410 00000001 c0000001 00020000 00800000 00000300 00064002 00000000 00000640 |