On Target PPAP_HUMAN 0.17/CHEMBL507996
For the given ligand Acetaminophen, we have found in our database that, being scored 0.17, the most similar ligand is CHEMBL507996. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL507996 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | Cl.COc1ccc(cc1)[C@@H](N[C@H](C)c2ccccc2)P(=O)(O)O |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00010010 00000608 20000108 00010600 00001000 00400000 06040000 82001000 000000c0 00080840 08200000 40008000 00000802 00020000 8108040d 00000008 00003028 02000000 00000000 00020200 00000000 0d308000 00000000 00400010 00000000 c6010006 00220000 80014000 00000300 30060002 00040000 00028603 |