On Target PDE4B_HUMAN 0.5181818/CHEMBL3315269
For the given ligand Diclophenac, we have found in our database that, being scored 0.5181818, the most similar ligand is CHEMBL3315269. Check out the elaboration below.
| Diclophenac (Given Ligand) | CHEMBL3315269 (Similar Ligand) |
|---|---|
| O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl | CCc1nc(Nc2ccc(CC(=O)O)cc2)nc(n1)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 | 00008002 00000800 80000100 40010200 05000040 00000000 04000000 00080840 00000100 000c0840 08208004 40009800 07008004 00108000 c0060040 1808000c 08048800 12006000 08000008 10204000 40000000 08402b00 61006000 00400014 00002000 81000200 00000008 000010a0 0000800c 00660002 c0002800 20020402 |