On Target PERM_HUMAN 0.41573033/CHEMBL686
For the given ligand Diclophenac, we have found in our database that, being scored 0.41573033, the most similar ligand is CHEMBL686. Check out the elaboration below.
| Diclophenac (Given Ligand) | CHEMBL686 (Similar Ligand) |
|---|---|
| O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl | Cc1cccc(Nc2ccccc2C(=O)O)c1C |
|
|
|
|
|
|
| 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 | 00000002 00000800 00000100 00010200 00000000 00014000 00000010 00000040 00802100 00400850 00200004 40009000 04008000 00200000 00020040 00080008 00040000 02000000 0800800a 00000000 41000000 08020a20 20000000 00400004 00040000 80000000 02000000 00001080 00408000 00260000 c0000000 00000000 |