On Target AMPN_HUMAN 0.34020618/CHEMBL2332527
For the given ligand Acetaminophen, we have found in our database that, being scored 0.34020618, the most similar ligand is CHEMBL2332527. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL2332527 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | COc1ccccc1NC(=O)N[C@@H](CC(C)C)C(=O)NO |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00010006 01003018 60100008 00000e00 80001000 00000000 06000004 00002021 00000000 000208c0 00280004 4001b000 0400b006 00100000 01000041 00004418 00040000 08400010 08000000 000e0001 40000100 38050600 20022000 00010018 00110800 00000000 20000040 10000080 08008200 00060005 20084000 00404200 |