On Target TRPV1_RAT 0.34615386/CHEMBL185683
For the given ligand Rf Furano, we have found in our database that, being scored 0.34615386, the most similar ligand is CHEMBL185683. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL185683 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | CC(C)(C)c1ccc(CNC(=O)Cc2ccc(NS(=O)(=O)C)cc2)cc1 |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 00000002 00800800 00100102 40310600 00000000 00000000 00000000 02001000 00000180 00080840 08202004 40009800 81008c02 00000001 c0080440 00020000 00000000 02000000 00000000 00004200 c0000000 18208e00 20000000 81400018 00000080 c0000000 00000000 8000000c 04000100 00060003 20042000 00010660 |