On Target SC6A4_HUMAN 0.4888889/CHEMBL3612827
For the given ligand Rf Furano, we have found in our database that, being scored 0.4888889, the most similar ligand is CHEMBL3612827. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL3612827 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | O=C(NCCCN1CCC(Cc2ccccc2)CC1)c3oc4ccccc4c3 |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 00010080 01201c00 00180102 00010600 04000200 00000000 00000000 62201200 02104900 000809e0 08300030 50019000 44008c0a 00200088 00000420 00000000 00004000 02000000 00000000 00000201 00000100 180e8608 00000000 0058021c 08800020 e0000000 04100014 98000000 00002180 01060013 a0040000 00002600 |