On Target HYES_HUMAN 0.5471698/CHEMBL381544
For the given ligand Rf Furano, we have found in our database that, being scored 0.5471698, the most similar ligand is CHEMBL381544. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL381544 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | CC(C)(C)c1ccc(cc1)C(=O)NCc2ccc(cc2)S(=O)(=O)N |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 00000010 00801800 01000100 40b10600 00000008 00000000 00000000 02001000 00000100 00080840 08202000 60008800 80008802 00000001 80200400 00000000 00002000 02000000 00000000 00002000 80000000 080a8600 00000000 0840001c 00000000 c0000000 00000000 80000028 00000100 20060003 80040000 00010620 |