On Target AOFA_HUMAN 0.38513514/CHEMBL1814057
For the given ligand Rf Furano, we have found in our database that, being scored 0.38513514, the most similar ligand is CHEMBL1814057. Check out the elaboration below.
| Rf Furano (Given Ligand) | CHEMBL1814057 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c3ccc(C(=O)N2CCN(C(=O)c1ccco1)CC2)cc3 | Oc1ccc(NC(=O)C2=CC(=O)c3ccccc3O2)cc1O |
|
|
|
|
|
|
| 00010090 00a03800 01080100 04b10600 04000008 00000000 00000000 02201008 02004100 00010840 00202030 60009000 44008c12 00002009 80200420 00000000 00004000 02000001 00000000 00002000 80000000 280e8600 00000020 0a48020c 00800020 e0000000 04100010 88000028 08000180 20060001 80040000 00010220 | 00004082 80200808 20080100 00010600 14000200 80000020 02000000 42001200 02004100 40000840 00280014 4000d000 44008c22 00300088 00000060 00008008 00044080 02000000 0a000008 00022400 40100000 08028608 20012000 40580204 08800800 a0000080 04140034 88100080 0000a180 05860001 80040000 00000200 |